C38H44N2O10 — CID 174502018
bis[[3-(3,4-dimethoxyphenyl)-1-phenylpropyl]amino] 2,3-dihydroxybutanedioate (PubChem CID 174502018) has the molecular formula C38H44N2O10 and a molecular weight of 688.77 g/mol. Its IUPAC name is bis[[3-(3,4-dimethoxyphenyl)-1-phenylpropyl]amino] 2,3-dihydroxybutanedioate.
| Compound Name | bis[[3-(3,4-dimethoxyphenyl)-1-phenylpropyl]amino] 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 174502018 |
| Molecular Formula | C38H44N2O10 |
| Molecular Weight | 688.77 g/mol |
| Exact Mass | 688.30 |
| IUPAC Name | bis[[3-(3,4-dimethoxyphenyl)-1-phenylpropyl]amino] 2,3-dihydroxybutanedioate |
| SMILES | COc1ccc(CCC(NOC(=O)C(O)C(O)C(=O)ONC(CCc2ccc(OC)c(OC)c2)c2ccccc2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C38H44N2O10/c1-45-31-21-17-25(23-33(31)47-3)15-19-29(27-11-7-5-8-12-27)39-49-37(43)35(41)36(42)38(44)50-40-30(28-13-9-6-10-14-28)20-16-26-18-22-32(46-2)34(24-26)48-4/h5-14,17-18,21-24,29-30,35-36,39-42H,15-16,19-20H2,1-4H3 |
| InChIKey | AWCKNJLWTHJPNR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 154.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.77 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|