C25H25NO5 — CID 54573334
2-(3,4-dimethoxyphenyl)ethyl N-(2,2-diphenylacetyl)carbamate (PubChem CID 54573334) has the molecular formula C25H25NO5 and a molecular weight of 419.48 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)ethyl N-(2,2-diphenylacetyl)carbamate.
| Compound Name | 2-(3,4-dimethoxyphenyl)ethyl N-(2,2-diphenylacetyl)carbamate |
|---|---|
| PubChem CID | 54573334 |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)ethyl N-(2,2-diphenylacetyl)carbamate |
| SMILES | COc1ccc(CCOC(=O)NC(=O)C(c2ccccc2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C25H25NO5/c1-29-21-14-13-18(17-22(21)30-2)15-16-31-25(28)26-24(27)23(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-14,17,23H,15-16H2,1-2H3,(H,26,27,28) |
| InChIKey | ZYVWCKJQEMXWLN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |