About alumane;propan-2-yl 3-oxo-2-propan-2-yloxybutanoate
alumane;propan-2-yl 3-oxo-2-propan-2-yloxybutanoate (PubChem CID 174502604) has the molecular formula C10H21AlO4
and a molecular weight of 232.26 g/mol. Its IUPAC name is alumane;propan-2-yl 3-oxo-2-propan-2-yloxybutanoate.
Molecular Properties
| Compound Name | alumane;propan-2-yl 3-oxo-2-propan-2-yloxybutanoate |
| PubChem CID | 174502604 |
| Molecular Formula | C10H21AlO4 |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | alumane;propan-2-yl 3-oxo-2-propan-2-yloxybutanoate |
| SMILES | CC(=O)C(OC(C)C)C(=O)OC(C)C.[AlH3] |
| InChI | InChI=1S/C10H18O4.Al.3H/c1-6(2)13-9(8(5)11)10(12)14-7(3)4;;;;/h6-7,9H,1-5H3;;;; |
| InChIKey | IECSHJPHTYOOFR-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze alumane;propan-2-yl 3-oxo-2-propan-2-yloxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;propan-2-yl 3-oxo-2-propan-2-yloxybutanoate?
The IUPAC name of alumane;propan-2-yl 3-oxo-2-propan-2-yloxybutanoate (CID 174502604) is alumane;propan-2-yl 3-oxo-2-propan-2-yloxybutanoate.
What is the SMILES notation for alumane;propan-2-yl 3-oxo-2-propan-2-yloxybutanoate?
The canonical SMILES for alumane;propan-2-yl 3-oxo-2-propan-2-yloxybutanoate is CC(=O)C(OC(C)C)C(=O)OC(C)C.[AlH3].
What is the InChIKey of alumane;propan-2-yl 3-oxo-2-propan-2-yloxybutanoate?
The InChIKey is IECSHJPHTYOOFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4.Al.3H/c1-6(2)13-9(8(5)11)10(12)14-7(3)4;;;;/h6-7,9H,1-5H3;;;;.
What are the key properties of alumane;propan-2-yl 3-oxo-2-propan-2-yloxybutanoate?
alumane;propan-2-yl 3-oxo-2-propan-2-yloxybutanoate has a molecular weight of 232.26 g/mol, XLogP of 0.14, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;propan-2-yl 3-oxo-2-propan-2-yloxybutanoate is sourced from PubChem (CID 174502604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).