C15H17F3N2O3S — CID 17450703
N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]cyclohex-3-ene-1-carboxamide (PubChem CID 17450703) has the molecular formula C15H17F3N2O3S and a molecular weight of 362.37 g/mol. Its IUPAC name is N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 17450703 |
| Molecular Formula | C15H17F3N2O3S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NCC(F)(F)F)cc1)C1CC=CCC1 |
| InChI | InChI=1S/C15H17F3N2O3S/c16-15(17,18)10-19-24(22,23)13-8-6-12(7-9-13)20-14(21)11-4-2-1-3-5-11/h1-2,6-9,11,19H,3-5,10H2,(H,20,21) |
| InChIKey | MRYJXNXMZCNQEY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|