C22H26 — CID 174513680
1-methyl-6-propan-2-yl-1,2,3,4,5,6-hexahydrochrysene (PubChem CID 174513680) has the molecular formula C22H26 and a molecular weight of 290.45 g/mol. Its IUPAC name is 1-methyl-6-propan-2-yl-1,2,3,4,5,6-hexahydrochrysene.
| Compound Name | 1-methyl-6-propan-2-yl-1,2,3,4,5,6-hexahydrochrysene |
|---|---|
| PubChem CID | 174513680 |
| Molecular Formula | C22H26 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-methyl-6-propan-2-yl-1,2,3,4,5,6-hexahydrochrysene |
| SMILES | CC1CCCc2c1ccc1c2CC(C(C)C)c2ccccc2-1 |
| InChI | InChI=1S/C22H26/c1-14(2)21-13-22-17-10-6-7-15(3)16(17)11-12-20(22)18-8-4-5-9-19(18)21/h4-5,8-9,11-12,14-15,21H,6-7,10,13H2,1-3H3 |
| InChIKey | RBQCBGUAPFQTDT-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |