C19H15N4O3S- — CID 174515980
[3-carbamoyl-4-(3-cyanoanilino)-8-methylquinolin-6-yl]methanesulfinate (PubChem CID 174515980) has the molecular formula C19H15N4O3S- and a molecular weight of 379.42 g/mol. Its IUPAC name is [3-carbamoyl-4-(3-cyanoanilino)-8-methylquinolin-6-yl]methanesulfinate.
| Compound Name | [3-carbamoyl-4-(3-cyanoanilino)-8-methylquinolin-6-yl]methanesulfinate |
|---|---|
| PubChem CID | 174515980 |
| Molecular Formula | C19H15N4O3S- |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | [3-carbamoyl-4-(3-cyanoanilino)-8-methylquinolin-6-yl]methanesulfinate |
| SMILES | Cc1cc(CS(=O)[O-])cc2c(Nc3cccc(C#N)c3)c(C(N)=O)cnc12 |
| InChI | InChI=1S/C19H16N4O3S/c1-11-5-13(10-27(25)26)7-15-17(11)22-9-16(19(21)24)18(15)23-14-4-2-3-12(6-14)8-20/h2-7,9H,10H2,1H3,(H2,21,24)(H,22,23)(H,25,26)/p-1 |
| InChIKey | UTBLIGAYMXWYHD-UHFFFAOYSA-M |
| XLogP | 2.64 |
| TPSA | 131.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|