C17H25NO5 — CID 174516745
4-[(2-methylpropan-2-yl)oxycarbonyl]-2-(pentylamino)oxybenzoic acid (PubChem CID 174516745) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxycarbonyl]-2-(pentylamino)oxybenzoic acid.
| Compound Name | 4-[(2-methylpropan-2-yl)oxycarbonyl]-2-(pentylamino)oxybenzoic acid |
|---|---|
| PubChem CID | 174516745 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxycarbonyl]-2-(pentylamino)oxybenzoic acid |
| SMILES | CCCCCNOc1cc(C(=O)OC(C)(C)C)ccc1C(=O)O |
| InChI | InChI=1S/C17H25NO5/c1-5-6-7-10-18-23-14-11-12(8-9-13(14)15(19)20)16(21)22-17(2,3)4/h8-9,11,18H,5-7,10H2,1-4H3,(H,19,20) |
| InChIKey | PEIVQPVQQYOJRJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|