C25H27NO — CID 174523936
1-amino-2-cyclopentyl-7,7-dimethyl-6,8-dihydrochrysen-5-one (PubChem CID 174523936) has the molecular formula C25H27NO and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-amino-2-cyclopentyl-7,7-dimethyl-6,8-dihydrochrysen-5-one.
| Compound Name | 1-amino-2-cyclopentyl-7,7-dimethyl-6,8-dihydrochrysen-5-one |
|---|---|
| PubChem CID | 174523936 |
| Molecular Formula | C25H27NO |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-amino-2-cyclopentyl-7,7-dimethyl-6,8-dihydrochrysen-5-one |
| SMILES | CC1(C)CC=CC2=C1CC(=O)c1c2ccc2c(N)c(C3CCCC3)ccc12 |
| InChI | InChI=1S/C25H27NO/c1-25(2)13-5-8-17-18-11-12-20-19(23(18)22(27)14-21(17)25)10-9-16(24(20)26)15-6-3-4-7-15/h5,8-12,15H,3-4,6-7,13-14,26H2,1-2H3 |
| InChIKey | RXIAPUNIPOUYGE-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|