C20H31F3N2O — CID 174524426
1-methyl-4-[(2R)-2-[3-(trifluoromethoxy)phenyl]octyl]piperazine (PubChem CID 174524426) has the molecular formula C20H31F3N2O and a molecular weight of 372.48 g/mol. Its IUPAC name is 1-methyl-4-[(2R)-2-[3-(trifluoromethoxy)phenyl]octyl]piperazine.
| Compound Name | 1-methyl-4-[(2R)-2-[3-(trifluoromethoxy)phenyl]octyl]piperazine |
|---|---|
| PubChem CID | 174524426 |
| Molecular Formula | C20H31F3N2O |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 1-methyl-4-[(2R)-2-[3-(trifluoromethoxy)phenyl]octyl]piperazine |
| SMILES | CCCCCC[C@@H](CN1CCN(C)CC1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C20H31F3N2O/c1-3-4-5-6-8-18(16-25-13-11-24(2)12-14-25)17-9-7-10-19(15-17)26-20(21,22)23/h7,9-10,15,18H,3-6,8,11-14,16H2,1-2H3/t18-/m0/s1 |
| InChIKey | CDOLGZOAJWMJQV-SFHVURJKSA-N |
| XLogP | 4.89 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|