C17H16F3N5OS — CID 174526015
5-[2-[3-amino-5-(trifluoromethyl)anilino]pyrimidin-4-yl]-3,4-dimethyl-2H-1,3-thiazole-2-carbaldehyde (PubChem CID 174526015) has the molecular formula C17H16F3N5OS and a molecular weight of 395.41 g/mol. Its IUPAC name is 5-[2-[3-amino-5-(trifluoromethyl)anilino]pyrimidin-4-yl]-3,4-dimethyl-2H-1,3-thiazole-2-carbaldehyde.
| Compound Name | 5-[2-[3-amino-5-(trifluoromethyl)anilino]pyrimidin-4-yl]-3,4-dimethyl-2H-1,3-thiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 174526015 |
| Molecular Formula | C17H16F3N5OS |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 5-[2-[3-amino-5-(trifluoromethyl)anilino]pyrimidin-4-yl]-3,4-dimethyl-2H-1,3-thiazole-2-carbaldehyde |
| SMILES | CC1=C(c2ccnc(Nc3cc(N)cc(C(F)(F)F)c3)n2)SC(C=O)N1C |
| InChI | InChI=1S/C17H16F3N5OS/c1-9-15(27-14(8-26)25(9)2)13-3-4-22-16(24-13)23-12-6-10(17(18,19)20)5-11(21)7-12/h3-8,14H,21H2,1-2H3,(H,22,23,24) |
| InChIKey | XPIQBHHXKDHKOT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|