About diazidolead;methane
diazidolead;methane (PubChem CID 174527611) has the molecular formula CH4N6Pb
and a molecular weight of 307.29 g/mol. Its IUPAC name is diazidolead;methane.
Molecular Properties
| Compound Name | diazidolead;methane |
| PubChem CID | 174527611 |
| Molecular Formula | CH4N6Pb |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | diazidolead;methane |
| SMILES | C.[N-]=[N+]=N[Pb]N=[N+]=[N-] |
| InChI | InChI=1S/CH4.2N3.Pb/c;2*1-3-2;/h1H4;;;/q;2*-1;+2 |
| InChIKey | RBNNZEAZXBQXBT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze diazidolead;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazidolead;methane?
The IUPAC name of diazidolead;methane (CID 174527611) is diazidolead;methane.
What is the SMILES notation for diazidolead;methane?
The canonical SMILES for diazidolead;methane is C.[N-]=[N+]=N[Pb]N=[N+]=[N-].
What is the InChIKey of diazidolead;methane?
The InChIKey is RBNNZEAZXBQXBT-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4.2N3.Pb/c;2*1-3-2;/h1H4;;;/q;2*-1;+2.
What are the key properties of diazidolead;methane?
diazidolead;methane has a molecular weight of 307.29 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diazidolead;methane is sourced from PubChem (CID 174527611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).