C15H23N — CID 174528060
4-benzyl-N,2,2-trimethylcyclopentan-1-amine (PubChem CID 174528060) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 4-benzyl-N,2,2-trimethylcyclopentan-1-amine.
| Compound Name | 4-benzyl-N,2,2-trimethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 174528060 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 4-benzyl-N,2,2-trimethylcyclopentan-1-amine |
| SMILES | CNC1CC(Cc2ccccc2)CC1(C)C |
| InChI | InChI=1S/C15H23N/c1-15(2)11-13(10-14(15)16-3)9-12-7-5-4-6-8-12/h4-8,13-14,16H,9-11H2,1-3H3 |
| InChIKey | ZVFPXXPDQCWTNM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |