C5H5N5O3 — CID 174529766
2,6-diamino-5-nitropyrimidine-4-carbaldehyde (PubChem CID 174529766) has the molecular formula C5H5N5O3 and a molecular weight of 183.13 g/mol. Its IUPAC name is 2,6-diamino-5-nitropyrimidine-4-carbaldehyde.
| Compound Name | 2,6-diamino-5-nitropyrimidine-4-carbaldehyde |
|---|---|
| PubChem CID | 174529766 |
| Molecular Formula | C5H5N5O3 |
| Molecular Weight | 183.13 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | 2,6-diamino-5-nitropyrimidine-4-carbaldehyde |
| SMILES | Nc1nc(N)c([N+](=O)[O-])c(C=O)n1 |
| InChI | InChI=1S/C5H5N5O3/c6-4-3(10(12)13)2(1-11)8-5(7)9-4/h1H,(H4,6,7,8,9) |
| InChIKey | UBVLKYVZYODFCQ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 138.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.13 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|