C19H23N3O — CID 174530352
2-(4-methyl-2,2-diphenylpiperazin-1-yl)acetamide (PubChem CID 174530352) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-(4-methyl-2,2-diphenylpiperazin-1-yl)acetamide.
| Compound Name | 2-(4-methyl-2,2-diphenylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 174530352 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 2-(4-methyl-2,2-diphenylpiperazin-1-yl)acetamide |
| SMILES | CN1CCN(CC(N)=O)C(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C19H23N3O/c1-21-12-13-22(14-18(20)23)19(15-21,16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11H,12-15H2,1H3,(H2,20,23) |
| InChIKey | SBZRUANLPQCCHM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |