C17H17N3O5 — CID 174533895
2-amino-N-(6-bicyclo[3.1.0]hexa-1(6),2,4-trienyl)-6-nitrobenzamide;methyl propanoate (PubChem CID 174533895) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is 2-amino-N-(6-bicyclo[3.1.0]hexa-1(6),2,4-trienyl)-6-nitrobenzamide;methyl propanoate.
| Compound Name | 2-amino-N-(6-bicyclo[3.1.0]hexa-1(6),2,4-trienyl)-6-nitrobenzamide;methyl propanoate |
|---|---|
| PubChem CID | 174533895 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 2-amino-N-(6-bicyclo[3.1.0]hexa-1(6),2,4-trienyl)-6-nitrobenzamide;methyl propanoate |
| SMILES | CCC(=O)OC.Nc1cccc([N+](=O)[O-])c1C(=O)Nc1c2cccc1-2 |
| InChI | InChI=1S/C13H9N3O3.C4H8O2/c14-9-5-2-6-10(16(18)19)11(9)13(17)15-12-7-3-1-4-8(7)12;1-3-4(5)6-2/h1-6H,14H2,(H,15,17);3H2,1-2H3 |
| InChIKey | HEIJUQRJFGGNQN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|