C11H18O7 — CID 174534052
1,5-dioxecane-2,4-dione;ethyl hydrogen carbonate (PubChem CID 174534052) has the molecular formula C11H18O7 and a molecular weight of 262.26 g/mol. Its IUPAC name is 1,5-dioxecane-2,4-dione;ethyl hydrogen carbonate.
| Compound Name | 1,5-dioxecane-2,4-dione;ethyl hydrogen carbonate |
|---|---|
| PubChem CID | 174534052 |
| Molecular Formula | C11H18O7 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 1,5-dioxecane-2,4-dione;ethyl hydrogen carbonate |
| SMILES | CCOC(=O)O.O=C1CC(=O)OCCCCCO1 |
| InChI | InChI=1S/C8H12O4.C3H6O3/c9-7-6-8(10)12-5-3-1-2-4-11-7;1-2-6-3(4)5/h1-6H2;2H2,1H3,(H,4,5) |
| InChIKey | SDBYFSJENRKAKJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|