About tert-butyl formate;1-(dimethylamino)piperidine-4-carbaldehyde
tert-butyl formate;1-(dimethylamino)piperidine-4-carbaldehyde (PubChem CID 174538047) has the molecular formula C13H26N2O3
and a molecular weight of 258.36 g/mol. Its IUPAC name is tert-butyl formate;1-(dimethylamino)piperidine-4-carbaldehyde.
Molecular Properties
| Compound Name | tert-butyl formate;1-(dimethylamino)piperidine-4-carbaldehyde |
| PubChem CID | 174538047 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | tert-butyl formate;1-(dimethylamino)piperidine-4-carbaldehyde |
| SMILES | CC(C)(C)OC=O.CN(C)N1CCC(C=O)CC1 |
| InChI | InChI=1S/C8H16N2O.C5H10O2/c1-9(2)10-5-3-8(7-11)4-6-10;1-5(2,3)7-4-6/h7-8H,3-6H2,1-2H3;4H,1-3H3 |
| InChIKey | NVGQUBHPEAZLAU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;1-(dimethylamino)piperidine-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;1-(dimethylamino)piperidine-4-carbaldehyde?
The IUPAC name of tert-butyl formate;1-(dimethylamino)piperidine-4-carbaldehyde (CID 174538047) is tert-butyl formate;1-(dimethylamino)piperidine-4-carbaldehyde.
What is the SMILES notation for tert-butyl formate;1-(dimethylamino)piperidine-4-carbaldehyde?
The canonical SMILES for tert-butyl formate;1-(dimethylamino)piperidine-4-carbaldehyde is CC(C)(C)OC=O.CN(C)N1CCC(C=O)CC1.
What is the InChIKey of tert-butyl formate;1-(dimethylamino)piperidine-4-carbaldehyde?
The InChIKey is NVGQUBHPEAZLAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O.C5H10O2/c1-9(2)10-5-3-8(7-11)4-6-10;1-5(2,3)7-4-6/h7-8H,3-6H2,1-2H3;4H,1-3H3.
What are the key properties of tert-butyl formate;1-(dimethylamino)piperidine-4-carbaldehyde?
tert-butyl formate;1-(dimethylamino)piperidine-4-carbaldehyde has a molecular weight of 258.36 g/mol, XLogP of 1.33, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;1-(dimethylamino)piperidine-4-carbaldehyde is sourced from PubChem (CID 174538047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).