C18H27NO3 — CID 174541568
N-(2-prop-2-enoxyoctan-4-yloxy)benzamide (PubChem CID 174541568) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is N-(2-prop-2-enoxyoctan-4-yloxy)benzamide.
| Compound Name | N-(2-prop-2-enoxyoctan-4-yloxy)benzamide |
|---|---|
| PubChem CID | 174541568 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | N-(2-prop-2-enoxyoctan-4-yloxy)benzamide |
| SMILES | C=CCOC(C)CC(CCCC)ONC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H27NO3/c1-4-6-12-17(14-15(3)21-13-5-2)22-19-18(20)16-10-8-7-9-11-16/h5,7-11,15,17H,2,4,6,12-14H2,1,3H3,(H,19,20) |
| InChIKey | YZLXCYVQNAOCRG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|