C11H17F3O4S — CID 174552831
ethyl 2-(6,6,6-trifluorohex-1-en-3-ylsulfonyl)propanoate (PubChem CID 174552831) has the molecular formula C11H17F3O4S and a molecular weight of 302.31 g/mol. Its IUPAC name is ethyl 2-(6,6,6-trifluorohex-1-en-3-ylsulfonyl)propanoate.
| Compound Name | ethyl 2-(6,6,6-trifluorohex-1-en-3-ylsulfonyl)propanoate |
|---|---|
| PubChem CID | 174552831 |
| Molecular Formula | C11H17F3O4S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | ethyl 2-(6,6,6-trifluorohex-1-en-3-ylsulfonyl)propanoate |
| SMILES | C=CC(CCC(F)(F)F)S(=O)(=O)C(C)C(=O)OCC |
| InChI | InChI=1S/C11H17F3O4S/c1-4-9(6-7-11(12,13)14)19(16,17)8(3)10(15)18-5-2/h4,8-9H,1,5-7H2,2-3H3 |
| InChIKey | WYNJKDDXRBEPDI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|