About 2-hydroxypropane-1-sulfonic acid;thioxanthen-9-one
2-hydroxypropane-1-sulfonic acid;thioxanthen-9-one (PubChem CID 174560627) has the molecular formula C16H16O5S2
and a molecular weight of 352.43 g/mol. Its IUPAC name is 2-hydroxypropane-1-sulfonic acid;thioxanthen-9-one.
Molecular Properties
| Compound Name | 2-hydroxypropane-1-sulfonic acid;thioxanthen-9-one |
| PubChem CID | 174560627 |
| Molecular Formula | C16H16O5S2 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 2-hydroxypropane-1-sulfonic acid;thioxanthen-9-one |
| SMILES | CC(O)CS(=O)(=O)O.O=c1c2ccccc2sc2ccccc12 |
| InChI | InChI=1S/C13H8OS.C3H8O4S/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-3(4)2-8(5,6)7/h1-8H;3-4H,2H2,1H3,(H,5,6,7) |
| InChIKey | RZGILGBHKOTWSR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropane-1-sulfonic acid;thioxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropane-1-sulfonic acid;thioxanthen-9-one?
The IUPAC name of 2-hydroxypropane-1-sulfonic acid;thioxanthen-9-one (CID 174560627) is 2-hydroxypropane-1-sulfonic acid;thioxanthen-9-one.
What is the SMILES notation for 2-hydroxypropane-1-sulfonic acid;thioxanthen-9-one?
The canonical SMILES for 2-hydroxypropane-1-sulfonic acid;thioxanthen-9-one is CC(O)CS(=O)(=O)O.O=c1c2ccccc2sc2ccccc12.
What is the InChIKey of 2-hydroxypropane-1-sulfonic acid;thioxanthen-9-one?
The InChIKey is RZGILGBHKOTWSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8OS.C3H8O4S/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-3(4)2-8(5,6)7/h1-8H;3-4H,2H2,1H3,(H,5,6,7).
What are the key properties of 2-hydroxypropane-1-sulfonic acid;thioxanthen-9-one?
2-hydroxypropane-1-sulfonic acid;thioxanthen-9-one has a molecular weight of 352.43 g/mol, XLogP of 2.67, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropane-1-sulfonic acid;thioxanthen-9-one is sourced from PubChem (CID 174560627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).