C19H20N2O2 — CID 174562275
7-amino-2,2-dimethyl-4-(2-phenylethenyl)-3H-1,4-benzoxazine-3-carbaldehyde (PubChem CID 174562275) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 7-amino-2,2-dimethyl-4-(2-phenylethenyl)-3H-1,4-benzoxazine-3-carbaldehyde.
| Compound Name | 7-amino-2,2-dimethyl-4-(2-phenylethenyl)-3H-1,4-benzoxazine-3-carbaldehyde |
|---|---|
| PubChem CID | 174562275 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 7-amino-2,2-dimethyl-4-(2-phenylethenyl)-3H-1,4-benzoxazine-3-carbaldehyde |
| SMILES | CC1(C)Oc2cc(N)ccc2N(C=Cc2ccccc2)C1C=O |
| InChI | InChI=1S/C19H20N2O2/c1-19(2)18(13-22)21(11-10-14-6-4-3-5-7-14)16-9-8-15(20)12-17(16)23-19/h3-13,18H,20H2,1-2H3 |
| InChIKey | PAFWBDKFGHZXAP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|