C19H23FN4O2 — CID 174651460
7-amino-2,2-bis(ethylamino)-4-(4-fluorophenyl)-3H-1,4-benzoxazine-3-carbaldehyde (PubChem CID 174651460) has the molecular formula C19H23FN4O2 and a molecular weight of 358.42 g/mol. Its IUPAC name is 7-amino-2,2-bis(ethylamino)-4-(4-fluorophenyl)-3H-1,4-benzoxazine-3-carbaldehyde.
| Compound Name | 7-amino-2,2-bis(ethylamino)-4-(4-fluorophenyl)-3H-1,4-benzoxazine-3-carbaldehyde |
|---|---|
| PubChem CID | 174651460 |
| Molecular Formula | C19H23FN4O2 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 7-amino-2,2-bis(ethylamino)-4-(4-fluorophenyl)-3H-1,4-benzoxazine-3-carbaldehyde |
| SMILES | CCNC1(NCC)Oc2cc(N)ccc2N(c2ccc(F)cc2)C1C=O |
| InChI | InChI=1S/C19H23FN4O2/c1-3-22-19(23-4-2)18(12-25)24(15-8-5-13(20)6-9-15)16-10-7-14(21)11-17(16)26-19/h5-12,18,22-23H,3-4,21H2,1-2H3 |
| InChIKey | MWBXQWKTBJAXDG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|