About cyclohexene;4-nitrobenzene-1,2-diol
cyclohexene;4-nitrobenzene-1,2-diol (PubChem CID 174564201) has the molecular formula C12H15NO4
and a molecular weight of 237.26 g/mol. Its IUPAC name is cyclohexene;4-nitrobenzene-1,2-diol.
Molecular Properties
| Compound Name | cyclohexene;4-nitrobenzene-1,2-diol |
| PubChem CID | 174564201 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | cyclohexene;4-nitrobenzene-1,2-diol |
| SMILES | C1=CCCCC1.O=[N+]([O-])c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C6H5NO4.C6H10/c8-5-2-1-4(7(10)11)3-6(5)9;1-2-4-6-5-3-1/h1-3,8-9H;1-2H,3-6H2 |
| InChIKey | UYIHDRQVBPSFSA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclohexene;4-nitrobenzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexene;4-nitrobenzene-1,2-diol?
The IUPAC name of cyclohexene;4-nitrobenzene-1,2-diol (CID 174564201) is cyclohexene;4-nitrobenzene-1,2-diol.
What is the SMILES notation for cyclohexene;4-nitrobenzene-1,2-diol?
The canonical SMILES for cyclohexene;4-nitrobenzene-1,2-diol is C1=CCCCC1.O=[N+]([O-])c1ccc(O)c(O)c1.
What is the InChIKey of cyclohexene;4-nitrobenzene-1,2-diol?
The InChIKey is UYIHDRQVBPSFSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO4.C6H10/c8-5-2-1-4(7(10)11)3-6(5)9;1-2-4-6-5-3-1/h1-3,8-9H;1-2H,3-6H2.
What are the key properties of cyclohexene;4-nitrobenzene-1,2-diol?
cyclohexene;4-nitrobenzene-1,2-diol has a molecular weight of 237.26 g/mol, XLogP of 3.12, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexene;4-nitrobenzene-1,2-diol is sourced from PubChem (CID 174564201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).