About dec-5-en-5-yl-di(propan-2-yl)phosphane;tetrachlorozirconium
dec-5-en-5-yl-di(propan-2-yl)phosphane;tetrachlorozirconium (PubChem CID 174566024) has the molecular formula C16H33Cl4PZr
and a molecular weight of 489.45 g/mol. Its IUPAC name is dec-5-en-5-yl-di(propan-2-yl)phosphane;tetrachlorozirconium.
Molecular Properties
| Compound Name | dec-5-en-5-yl-di(propan-2-yl)phosphane;tetrachlorozirconium |
| PubChem CID | 174566024 |
| Molecular Formula | C16H33Cl4PZr |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 486.01 |
| IUPAC Name | dec-5-en-5-yl-di(propan-2-yl)phosphane;tetrachlorozirconium |
| SMILES | CCCCC=C(CCCC)P(C(C)C)C(C)C.Cl[Zr](Cl)(Cl)Cl |
| InChI | InChI=1S/C16H33P.4ClH.Zr/c1-7-9-11-13-16(12-10-8-2)17(14(3)4)15(5)6;;;;;/h13-15H,7-12H2,1-6H3;4*1H;/q;;;;;+4/p-4 |
| InChIKey | SLNLUETZPWAAEU-UHFFFAOYSA-J |
| XLogP | 9.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dec-5-en-5-yl-di(propan-2-yl)phosphane;tetrachlorozirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dec-5-en-5-yl-di(propan-2-yl)phosphane;tetrachlorozirconium?
The IUPAC name of dec-5-en-5-yl-di(propan-2-yl)phosphane;tetrachlorozirconium (CID 174566024) is dec-5-en-5-yl-di(propan-2-yl)phosphane;tetrachlorozirconium.
What is the SMILES notation for dec-5-en-5-yl-di(propan-2-yl)phosphane;tetrachlorozirconium?
The canonical SMILES for dec-5-en-5-yl-di(propan-2-yl)phosphane;tetrachlorozirconium is CCCCC=C(CCCC)P(C(C)C)C(C)C.Cl[Zr](Cl)(Cl)Cl.
What is the InChIKey of dec-5-en-5-yl-di(propan-2-yl)phosphane;tetrachlorozirconium?
The InChIKey is SLNLUETZPWAAEU-UHFFFAOYSA-J. The full InChI is InChI=1S/C16H33P.4ClH.Zr/c1-7-9-11-13-16(12-10-8-2)17(14(3)4)15(5)6;;;;;/h13-15H,7-12H2,1-6H3;4*1H;/q;;;;;+4/p-4.
What are the key properties of dec-5-en-5-yl-di(propan-2-yl)phosphane;tetrachlorozirconium?
dec-5-en-5-yl-di(propan-2-yl)phosphane;tetrachlorozirconium has a molecular weight of 489.45 g/mol, XLogP of 9.30, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dec-5-en-5-yl-di(propan-2-yl)phosphane;tetrachlorozirconium is sourced from PubChem (CID 174566024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).