C23H27F4N3O3S — CID 174571577
3-[4-amino-3-[3-fluoro-4-[methyl(sulfino)amino]phenyl]-4-oxobutyl]-2-cyclohexyl-6-(trifluoromethyl)pyridine (PubChem CID 174571577) has the molecular formula C23H27F4N3O3S and a molecular weight of 501.55 g/mol. Its IUPAC name is 3-[4-amino-3-[3-fluoro-4-[methyl(sulfino)amino]phenyl]-4-oxobutyl]-2-cyclohexyl-6-(trifluoromethyl)pyridine.
| Compound Name | 3-[4-amino-3-[3-fluoro-4-[methyl(sulfino)amino]phenyl]-4-oxobutyl]-2-cyclohexyl-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 174571577 |
| Molecular Formula | C23H27F4N3O3S |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | 3-[4-amino-3-[3-fluoro-4-[methyl(sulfino)amino]phenyl]-4-oxobutyl]-2-cyclohexyl-6-(trifluoromethyl)pyridine |
| SMILES | CN(c1ccc(C(CCc2ccc(C(F)(F)F)nc2C2CCCCC2)C(N)=O)cc1F)S(=O)O |
| InChI | InChI=1S/C23H27F4N3O3S/c1-30(34(32)33)19-11-8-16(13-18(19)24)17(22(28)31)10-7-15-9-12-20(23(25,26)27)29-21(15)14-5-3-2-4-6-14/h8-9,11-14,17H,2-7,10H2,1H3,(H2,28,31)(H,32,33) |
| InChIKey | ZXPBGRPEIOPKTN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|