C24H20N2O5S2 — CID 174580037
2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)-sulfanylmethyl]phenyl]sulfonylamino]benzoic acid (PubChem CID 174580037) has the molecular formula C24H20N2O5S2 and a molecular weight of 480.57 g/mol. Its IUPAC name is 2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)-sulfanylmethyl]phenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)-sulfanylmethyl]phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 174580037 |
| Molecular Formula | C24H20N2O5S2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)-sulfanylmethyl]phenyl]sulfonylamino]benzoic acid |
| SMILES | Cc1oc(-c2ccccc2)nc1C(S)c1ccc(S(=O)(=O)Nc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C24H20N2O5S2/c1-15-21(25-23(31-15)17-7-3-2-4-8-17)22(32)16-11-13-18(14-12-16)33(29,30)26-20-10-6-5-9-19(20)24(27)28/h2-14,22,26,32H,1H3,(H,27,28) |
| InChIKey | AVMNAJKEMTZVTM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|