About ethylphosphane;trioctylphosphane
ethylphosphane;trioctylphosphane (PubChem CID 174580849) has the molecular formula C26H58P2
and a molecular weight of 432.70 g/mol. Its IUPAC name is ethylphosphane;trioctylphosphane.
Molecular Properties
| Compound Name | ethylphosphane;trioctylphosphane |
| PubChem CID | 174580849 |
| Molecular Formula | C26H58P2 |
| Molecular Weight | 432.70 g/mol |
| Exact Mass | 432.40 |
| IUPAC Name | ethylphosphane;trioctylphosphane |
| SMILES | CCCCCCCCP(CCCCCCCC)CCCCCCCC.CCP |
| InChI | InChI=1S/C24H51P.C2H7P/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-2-3/h4-24H2,1-3H3;2-3H2,1H3 |
| InChIKey | IXKHOXZCQGGOGQ-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.70 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethylphosphane;trioctylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylphosphane;trioctylphosphane?
The IUPAC name of ethylphosphane;trioctylphosphane (CID 174580849) is ethylphosphane;trioctylphosphane.
What is the SMILES notation for ethylphosphane;trioctylphosphane?
The canonical SMILES for ethylphosphane;trioctylphosphane is CCCCCCCCP(CCCCCCCC)CCCCCCCC.CCP.
What is the InChIKey of ethylphosphane;trioctylphosphane?
The InChIKey is IXKHOXZCQGGOGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51P.C2H7P/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-2-3/h4-24H2,1-3H3;2-3H2,1H3.
What are the key properties of ethylphosphane;trioctylphosphane?
ethylphosphane;trioctylphosphane has a molecular weight of 432.70 g/mol, XLogP of 10.43, 21 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethylphosphane;trioctylphosphane is sourced from PubChem (CID 174580849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).