C20H20N4 — CID 174580960
4-(aminodiazenyl)-2,3-dibenzylaniline (PubChem CID 174580960) has the molecular formula C20H20N4 and a molecular weight of 316.41 g/mol. Its IUPAC name is 4-(aminodiazenyl)-2,3-dibenzylaniline.
| Compound Name | 4-(aminodiazenyl)-2,3-dibenzylaniline |
|---|---|
| PubChem CID | 174580960 |
| Molecular Formula | C20H20N4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 4-(aminodiazenyl)-2,3-dibenzylaniline |
| SMILES | N/N=N/c1ccc(N)c(Cc2ccccc2)c1Cc1ccccc1 |
| InChI | InChI=1S/C20H20N4/c21-19-11-12-20(23-24-22)18(14-16-9-5-2-6-10-16)17(19)13-15-7-3-1-4-8-15/h1-12H,13-14,21H2,(H2,22,23) |
| InChIKey | RVQYLQUUVBWERM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|