About N-methyl-N-silylmethanamine;stibane
N-methyl-N-silylmethanamine;stibane (PubChem CID 174587628) has the molecular formula C2H12NSbSi
and a molecular weight of 199.97 g/mol. Its IUPAC name is N-methyl-N-silylmethanamine;stibane.
Molecular Properties
| Compound Name | N-methyl-N-silylmethanamine;stibane |
| PubChem CID | 174587628 |
| Molecular Formula | C2H12NSbSi |
| Molecular Weight | 199.97 g/mol |
| Exact Mass | 198.98 |
| IUPAC Name | N-methyl-N-silylmethanamine;stibane |
| SMILES | CN(C)[SiH3].[SbH3] |
| InChI | InChI=1S/C2H9NSi.Sb.3H/c1-3(2)4;;;;/h1-2,4H3;;;; |
| InChIKey | BKVCKRDBOHHBPZ-UHFFFAOYSA-N |
| XLogP | -2.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.97 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-silylmethanamine;stibane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-silylmethanamine;stibane?
The IUPAC name of N-methyl-N-silylmethanamine;stibane (CID 174587628) is N-methyl-N-silylmethanamine;stibane.
What is the SMILES notation for N-methyl-N-silylmethanamine;stibane?
The canonical SMILES for N-methyl-N-silylmethanamine;stibane is CN(C)[SiH3].[SbH3].
What is the InChIKey of N-methyl-N-silylmethanamine;stibane?
The InChIKey is BKVCKRDBOHHBPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H9NSi.Sb.3H/c1-3(2)4;;;;/h1-2,4H3;;;;.
What are the key properties of N-methyl-N-silylmethanamine;stibane?
N-methyl-N-silylmethanamine;stibane has a molecular weight of 199.97 g/mol, XLogP of -2.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-silylmethanamine;stibane is sourced from PubChem (CID 174587628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).