C20H22ClN5O5S — CID 174591565
N'-[1-(4-acetyl-3-chloro-2-sulfamoylphenyl)ethyl]-N'-(4-carbamimidoylphenyl)propanediamide (PubChem CID 174591565) has the molecular formula C20H22ClN5O5S and a molecular weight of 479.95 g/mol. Its IUPAC name is N'-[1-(4-acetyl-3-chloro-2-sulfamoylphenyl)ethyl]-N'-(4-carbamimidoylphenyl)propanediamide.
| Compound Name | N'-[1-(4-acetyl-3-chloro-2-sulfamoylphenyl)ethyl]-N'-(4-carbamimidoylphenyl)propanediamide |
|---|---|
| PubChem CID | 174591565 |
| Molecular Formula | C20H22ClN5O5S |
| Molecular Weight | 479.95 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | N'-[1-(4-acetyl-3-chloro-2-sulfamoylphenyl)ethyl]-N'-(4-carbamimidoylphenyl)propanediamide |
| SMILES | [H]/N=C(\N)c1ccc(N(C(=O)CC(N)=O)C(C)c2ccc(C(C)=O)c(Cl)c2S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H22ClN5O5S/c1-10(14-7-8-15(11(2)27)18(21)19(14)32(25,30)31)26(17(29)9-16(22)28)13-5-3-12(4-6-13)20(23)24/h3-8,10H,9H2,1-2H3,(H2,22,28)(H3,23,24)(H2,25,30,31) |
| InChIKey | OQHLDEXXUBIYDC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 190.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.95 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|