C25H24F3N5O3 — CID 68743788
N'-(4-carbamimidoylphenyl)-N'-[(1S)-1-[4-(pyridin-4-ylmethoxy)-3-(trifluoromethyl)phenyl]ethyl]propanediamide (PubChem CID 68743788) has the molecular formula C25H24F3N5O3 and a molecular weight of 499.49 g/mol. Its IUPAC name is N'-(4-carbamimidoylphenyl)-N'-[(1S)-1-[4-(pyridin-4-ylmethoxy)-3-(trifluoromethyl)phenyl]ethyl]propanediamide.
| Compound Name | N'-(4-carbamimidoylphenyl)-N'-[(1S)-1-[4-(pyridin-4-ylmethoxy)-3-(trifluoromethyl)phenyl]ethyl]propanediamide |
|---|---|
| PubChem CID | 68743788 |
| Molecular Formula | C25H24F3N5O3 |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | N'-(4-carbamimidoylphenyl)-N'-[(1S)-1-[4-(pyridin-4-ylmethoxy)-3-(trifluoromethyl)phenyl]ethyl]propanediamide |
| SMILES | [H]/N=C(\N)c1ccc(N(C(=O)CC(N)=O)[C@@H](C)c2ccc(OCc3ccncc3)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C25H24F3N5O3/c1-15(33(23(35)13-22(29)34)19-5-2-17(3-6-19)24(30)31)18-4-7-21(20(12-18)25(26,27)28)36-14-16-8-10-32-11-9-16/h2-12,15H,13-14H2,1H3,(H2,29,34)(H3,30,31)/t15-/m0/s1 |
| InChIKey | CZBNYCXRPNXUJD-HNNXBMFYSA-N |
| XLogP | 3.93 |
| TPSA | 135.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|