About 4-fluoro-1-[5-(5-methyl-1,2-oxazol-3-yl)-1,3-oxazol-2-yl]butan-1-one
4-fluoro-1-[5-(5-methyl-1,2-oxazol-3-yl)-1,3-oxazol-2-yl]butan-1-one (PubChem CID 174592375) has the molecular formula C11H11FN2O3
and a molecular weight of 238.22 g/mol. Its IUPAC name is 4-fluoro-1-[5-(5-methyl-1,2-oxazol-3-yl)-1,3-oxazol-2-yl]butan-1-one.
Molecular Properties
| Compound Name | 4-fluoro-1-[5-(5-methyl-1,2-oxazol-3-yl)-1,3-oxazol-2-yl]butan-1-one |
| PubChem CID | 174592375 |
| Molecular Formula | C11H11FN2O3 |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 4-fluoro-1-[5-(5-methyl-1,2-oxazol-3-yl)-1,3-oxazol-2-yl]butan-1-one |
| SMILES | Cc1cc(-c2cnc(C(=O)CCCF)o2)no1 |
| InChI | InChI=1S/C11H11FN2O3/c1-7-5-8(14-17-7)10-6-13-11(16-10)9(15)3-2-4-12/h5-6H,2-4H2,1H3 |
| InChIKey | NAAHMNRGODVICA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-fluoro-1-[5-(5-methyl-1,2-oxazol-3-yl)-1,3-oxazol-2-yl]butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1-[5-(5-methyl-1,2-oxazol-3-yl)-1,3-oxazol-2-yl]butan-1-one?
The IUPAC name of 4-fluoro-1-[5-(5-methyl-1,2-oxazol-3-yl)-1,3-oxazol-2-yl]butan-1-one (CID 174592375) is 4-fluoro-1-[5-(5-methyl-1,2-oxazol-3-yl)-1,3-oxazol-2-yl]butan-1-one.
What is the SMILES notation for 4-fluoro-1-[5-(5-methyl-1,2-oxazol-3-yl)-1,3-oxazol-2-yl]butan-1-one?
The canonical SMILES for 4-fluoro-1-[5-(5-methyl-1,2-oxazol-3-yl)-1,3-oxazol-2-yl]butan-1-one is Cc1cc(-c2cnc(C(=O)CCCF)o2)no1.
What is the InChIKey of 4-fluoro-1-[5-(5-methyl-1,2-oxazol-3-yl)-1,3-oxazol-2-yl]butan-1-one?
The InChIKey is NAAHMNRGODVICA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN2O3/c1-7-5-8(14-17-7)10-6-13-11(16-10)9(15)3-2-4-12/h5-6H,2-4H2,1H3.
What are the key properties of 4-fluoro-1-[5-(5-methyl-1,2-oxazol-3-yl)-1,3-oxazol-2-yl]butan-1-one?
4-fluoro-1-[5-(5-methyl-1,2-oxazol-3-yl)-1,3-oxazol-2-yl]butan-1-one has a molecular weight of 238.22 g/mol, XLogP of 2.57, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1-[5-(5-methyl-1,2-oxazol-3-yl)-1,3-oxazol-2-yl]butan-1-one is sourced from PubChem (CID 174592375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).