C25H24O7 — CID 174594571
formyl 2,3,4,5-tetrahydroxy-2,3,4-triphenylhexanoate (PubChem CID 174594571) has the molecular formula C25H24O7 and a molecular weight of 436.46 g/mol. Its IUPAC name is formyl 2,3,4,5-tetrahydroxy-2,3,4-triphenylhexanoate.
| Compound Name | formyl 2,3,4,5-tetrahydroxy-2,3,4-triphenylhexanoate |
|---|---|
| PubChem CID | 174594571 |
| Molecular Formula | C25H24O7 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | formyl 2,3,4,5-tetrahydroxy-2,3,4-triphenylhexanoate |
| SMILES | CC(O)C(O)(c1ccccc1)C(O)(c1ccccc1)C(O)(C(=O)OC=O)c1ccccc1 |
| InChI | InChI=1S/C25H24O7/c1-18(27)23(29,19-11-5-2-6-12-19)25(31,21-15-9-4-10-16-21)24(30,22(28)32-17-26)20-13-7-3-8-14-20/h2-18,27,29-31H,1H3 |
| InChIKey | DLMDLMGDBBVDCU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|