About 2-oxopropyl 4-bromobutanoate
2-oxopropyl 4-bromobutanoate (PubChem CID 174600319) has the molecular formula C7H11BrO3
and a molecular weight of 223.07 g/mol. Its IUPAC name is 2-oxopropyl 4-bromobutanoate.
Molecular Properties
| Compound Name | 2-oxopropyl 4-bromobutanoate |
| PubChem CID | 174600319 |
| Molecular Formula | C7H11BrO3 |
| Molecular Weight | 223.07 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | 2-oxopropyl 4-bromobutanoate |
| SMILES | CC(=O)COC(=O)CCCBr |
| InChI | InChI=1S/C7H11BrO3/c1-6(9)5-11-7(10)3-2-4-8/h2-5H2,1H3 |
| InChIKey | JYRUDQRYKUWEKN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.07 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-oxopropyl 4-bromobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopropyl 4-bromobutanoate?
The IUPAC name of 2-oxopropyl 4-bromobutanoate (CID 174600319) is 2-oxopropyl 4-bromobutanoate.
What is the SMILES notation for 2-oxopropyl 4-bromobutanoate?
The canonical SMILES for 2-oxopropyl 4-bromobutanoate is CC(=O)COC(=O)CCCBr.
What is the InChIKey of 2-oxopropyl 4-bromobutanoate?
The InChIKey is JYRUDQRYKUWEKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11BrO3/c1-6(9)5-11-7(10)3-2-4-8/h2-5H2,1H3.
What are the key properties of 2-oxopropyl 4-bromobutanoate?
2-oxopropyl 4-bromobutanoate has a molecular weight of 223.07 g/mol, XLogP of 1.29, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopropyl 4-bromobutanoate is sourced from PubChem (CID 174600319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).