C6H13NO4S — CID 174609615
2-amino-6,6-dihydroxy-3-sulfanylhexanoic acid (PubChem CID 174609615) has the molecular formula C6H13NO4S and a molecular weight of 195.24 g/mol. Its IUPAC name is 2-amino-6,6-dihydroxy-3-sulfanylhexanoic acid.
| Compound Name | 2-amino-6,6-dihydroxy-3-sulfanylhexanoic acid |
|---|---|
| PubChem CID | 174609615 |
| Molecular Formula | C6H13NO4S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 2-amino-6,6-dihydroxy-3-sulfanylhexanoic acid |
| SMILES | NC(C(=O)O)C(S)CCC(O)O |
| InChI | InChI=1S/C6H13NO4S/c7-5(6(10)11)3(12)1-2-4(8)9/h3-5,8-9,12H,1-2,7H2,(H,10,11) |
| InChIKey | HFGFZPWOKBJXOS-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|