About cobalt(2+);oxalate;tungsten
cobalt(2+);oxalate;tungsten (PubChem CID 174611740) has the molecular formula C2CoO4W
and a molecular weight of 330.79 g/mol. Its IUPAC name is cobalt(2+);oxalate;tungsten.
Molecular Properties
| Compound Name | cobalt(2+);oxalate;tungsten |
| PubChem CID | 174611740 |
| Molecular Formula | C2CoO4W |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.86 |
| IUPAC Name | cobalt(2+);oxalate;tungsten |
| SMILES | O=C([O-])C(=O)[O-].[Co+2].[W] |
| InChI | InChI=1S/C2H2O4.Co.W/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;+2;/p-2 |
| InChIKey | GMVGOMKJHGGNBS-UHFFFAOYSA-L |
| XLogP | -3.52 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze cobalt(2+);oxalate;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);oxalate;tungsten?
The IUPAC name of cobalt(2+);oxalate;tungsten (CID 174611740) is cobalt(2+);oxalate;tungsten.
What is the SMILES notation for cobalt(2+);oxalate;tungsten?
The canonical SMILES for cobalt(2+);oxalate;tungsten is O=C([O-])C(=O)[O-].[Co+2].[W].
What is the InChIKey of cobalt(2+);oxalate;tungsten?
The InChIKey is GMVGOMKJHGGNBS-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H2O4.Co.W/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;+2;/p-2.
What are the key properties of cobalt(2+);oxalate;tungsten?
cobalt(2+);oxalate;tungsten has a molecular weight of 330.79 g/mol, XLogP of -3.52, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);oxalate;tungsten is sourced from PubChem (CID 174611740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).