C24H34N2O2 — CID 174613786
3-benzyl-3-(dimethylamino)-1-phenylpentan-2-one;morpholine (PubChem CID 174613786) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is 3-benzyl-3-(dimethylamino)-1-phenylpentan-2-one;morpholine.
| Compound Name | 3-benzyl-3-(dimethylamino)-1-phenylpentan-2-one;morpholine |
|---|---|
| PubChem CID | 174613786 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | 3-benzyl-3-(dimethylamino)-1-phenylpentan-2-one;morpholine |
| SMILES | C1COCCN1.CCC(Cc1ccccc1)(C(=O)Cc1ccccc1)N(C)C |
| InChI | InChI=1S/C20H25NO.C4H9NO/c1-4-20(21(2)3,16-18-13-9-6-10-14-18)19(22)15-17-11-7-5-8-12-17;1-3-6-4-2-5-1/h5-14H,4,15-16H2,1-3H3;5H,1-4H2 |
| InChIKey | GTOICZCUQKTNSU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |