C19H29N3O3 — CID 174615275
[(3R)-1-[(2S)-6-amino-2-(benzylamino)hexanoyl]piperidin-3-yl] formate (PubChem CID 174615275) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is [(3R)-1-[(2S)-6-amino-2-(benzylamino)hexanoyl]piperidin-3-yl] formate.
| Compound Name | [(3R)-1-[(2S)-6-amino-2-(benzylamino)hexanoyl]piperidin-3-yl] formate |
|---|---|
| PubChem CID | 174615275 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | [(3R)-1-[(2S)-6-amino-2-(benzylamino)hexanoyl]piperidin-3-yl] formate |
| SMILES | NCCCC[C@H](NCc1ccccc1)C(=O)N1CCC[C@@H](OC=O)C1 |
| InChI | InChI=1S/C19H29N3O3/c20-11-5-4-10-18(21-13-16-7-2-1-3-8-16)19(24)22-12-6-9-17(14-22)25-15-23/h1-3,7-8,15,17-18,21H,4-6,9-14,20H2/t17-,18+/m1/s1 |
| InChIKey | KVNGQICZCBEFPH-MSOLQXFVSA-N |
| XLogP | 1.44 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|