C21H26N2O3 — CID 175356899
benzyl 6-amino-2-[(3-formylphenyl)methylamino]hexanoate (PubChem CID 175356899) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is benzyl 6-amino-2-[(3-formylphenyl)methylamino]hexanoate.
| Compound Name | benzyl 6-amino-2-[(3-formylphenyl)methylamino]hexanoate |
|---|---|
| PubChem CID | 175356899 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | benzyl 6-amino-2-[(3-formylphenyl)methylamino]hexanoate |
| SMILES | NCCCCC(NCc1cccc(C=O)c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H26N2O3/c22-12-5-4-11-20(21(25)26-16-17-7-2-1-3-8-17)23-14-18-9-6-10-19(13-18)15-24/h1-3,6-10,13,15,20,23H,4-5,11-12,14,16,22H2 |
| InChIKey | IGFXUDKIMXFBJS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|