C13H15F3O3 — CID 174615401
(3S)-3-[[3-hydroxy-5-(trifluoromethyl)phenyl]methyl]pentanoic acid (PubChem CID 174615401) has the molecular formula C13H15F3O3 and a molecular weight of 276.25 g/mol. Its IUPAC name is (3S)-3-[[3-hydroxy-5-(trifluoromethyl)phenyl]methyl]pentanoic acid.
| Compound Name | (3S)-3-[[3-hydroxy-5-(trifluoromethyl)phenyl]methyl]pentanoic acid |
|---|---|
| PubChem CID | 174615401 |
| Molecular Formula | C13H15F3O3 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (3S)-3-[[3-hydroxy-5-(trifluoromethyl)phenyl]methyl]pentanoic acid |
| SMILES | CC[C@H](CC(=O)O)Cc1cc(O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3O3/c1-2-8(6-12(18)19)3-9-4-10(13(14,15)16)7-11(17)5-9/h4-5,7-8,17H,2-3,6H2,1H3,(H,18,19)/t8-/m0/s1 |
| InChIKey | ZVXXPSCDDODJAY-QMMMGPOBSA-N |
| XLogP | 3.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |