About 2-iodobut-2-enamide
2-iodobut-2-enamide (PubChem CID 174630742) has the molecular formula C4H6INO
and a molecular weight of 211.00 g/mol. Its IUPAC name is 2-iodobut-2-enamide.
Molecular Properties
| Compound Name | 2-iodobut-2-enamide |
| PubChem CID | 174630742 |
| Molecular Formula | C4H6INO |
| Molecular Weight | 211.00 g/mol |
| Exact Mass | 210.95 |
| IUPAC Name | 2-iodobut-2-enamide |
| SMILES | CC=C(I)C(N)=O |
| InChI | InChI=1S/C4H6INO/c1-2-3(5)4(6)7/h2H,1H3,(H2,6,7) |
| InChIKey | PPMDRINGKKSYIS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.00 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-iodobut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodobut-2-enamide?
The IUPAC name of 2-iodobut-2-enamide (CID 174630742) is 2-iodobut-2-enamide.
What is the SMILES notation for 2-iodobut-2-enamide?
The canonical SMILES for 2-iodobut-2-enamide is CC=C(I)C(N)=O.
What is the InChIKey of 2-iodobut-2-enamide?
The InChIKey is PPMDRINGKKSYIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6INO/c1-2-3(5)4(6)7/h2H,1H3,(H2,6,7).
What are the key properties of 2-iodobut-2-enamide?
2-iodobut-2-enamide has a molecular weight of 211.00 g/mol, XLogP of 0.81, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodobut-2-enamide is sourced from PubChem (CID 174630742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).