C25H29N3O5 — CID 174631059
4-tert-butyl-N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxy-1,3-dihydroisoindol-5-yl]methyl]benzamide (PubChem CID 174631059) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is 4-tert-butyl-N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxy-1,3-dihydroisoindol-5-yl]methyl]benzamide.
| Compound Name | 4-tert-butyl-N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxy-1,3-dihydroisoindol-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 174631059 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 4-tert-butyl-N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dihydroxy-1,3-dihydroisoindol-5-yl]methyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NCc2ccc3c(c2)C(O)N(C2CCC(=O)NC2=O)C3O)cc1 |
| InChI | InChI=1S/C25H29N3O5/c1-25(2,3)16-7-5-15(6-8-16)21(30)26-13-14-4-9-17-18(12-14)24(33)28(23(17)32)19-10-11-20(29)27-22(19)31/h4-9,12,19,23-24,32-33H,10-11,13H2,1-3H3,(H,26,30)(H,27,29,31) |
| InChIKey | JLQNUDCSFORRBG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|