C29H34ClN7O5S — CID 174642262
(2Z)-6-(2-chlorophenyl)-2-[(4-methylpiperazin-1-yl)methylidene]-8-nitro-4H-imidazo[1,2-a][1,4]benzodiazepin-1-one;1-propylsulfonylazetidine (PubChem CID 174642262) has the molecular formula C29H34ClN7O5S and a molecular weight of 628.16 g/mol. Its IUPAC name is (2Z)-6-(2-chlorophenyl)-2-[(4-methylpiperazin-1-yl)methylidene]-8-nitro-4H-imidazo[1,2-a][1,4]benzodiazepin-1-one;1-propylsulfonylazetidine.
| Compound Name | (2Z)-6-(2-chlorophenyl)-2-[(4-methylpiperazin-1-yl)methylidene]-8-nitro-4H-imidazo[1,2-a][1,4]benzodiazepin-1-one;1-propylsulfonylazetidine |
|---|---|
| PubChem CID | 174642262 |
| Molecular Formula | C29H34ClN7O5S |
| Molecular Weight | 628.16 g/mol |
| Exact Mass | 627.20 |
| IUPAC Name | (2Z)-6-(2-chlorophenyl)-2-[(4-methylpiperazin-1-yl)methylidene]-8-nitro-4H-imidazo[1,2-a][1,4]benzodiazepin-1-one;1-propylsulfonylazetidine |
| SMILES | CCCS(=O)(=O)N1CCC1.CN1CCN(/C=C2\N=C3CN=C(c4ccccc4Cl)c4cc([N+](=O)[O-])ccc4N3C2=O)CC1 |
| InChI | InChI=1S/C23H21ClN6O3.C6H13NO2S/c1-27-8-10-28(11-9-27)14-19-23(31)29-20-7-6-15(30(32)33)12-17(20)22(25-13-21(29)26-19)16-4-2-3-5-18(16)24;1-2-6-10(8,9)7-4-3-5-7/h2-7,12,14H,8-11,13H2,1H3;2-6H2,1H3/b19-14-; |
| InChIKey | OIWMUVKYRSBFSG-YEBWQKSTSA-N |
| XLogP | 3.37 |
| TPSA | 132.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.16 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|