C28H29ClN6O9 — CID 3036449
(2E)-6-(2-chlorophenyl)-2-[(4-ethylpiperazin-1-yl)methylidene]-8-nitro-4H-imidazo[1,2-a][1,4]benzodiazepin-1-one;(2R,3R)-2,3-dihydroxybutanedioic acid (PubChem CID 3036449) has the molecular formula C28H29ClN6O9 and a molecular weight of 629.03 g/mol. Its IUPAC name is (2E)-6-(2-chlorophenyl)-2-[(4-ethylpiperazin-1-yl)methylidene]-8-nitro-4H-imidazo[1,2-a][1,4]benzodiazepin-1-one;(2R,3R)-2,3-dihydroxybutanedioic acid.
| Compound Name | (2E)-6-(2-chlorophenyl)-2-[(4-ethylpiperazin-1-yl)methylidene]-8-nitro-4H-imidazo[1,2-a][1,4]benzodiazepin-1-one;(2R,3R)-2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 3036449 |
| Molecular Formula | C28H29ClN6O9 |
| Molecular Weight | 629.03 g/mol |
| Exact Mass | 628.17 |
| IUPAC Name | (2E)-6-(2-chlorophenyl)-2-[(4-ethylpiperazin-1-yl)methylidene]-8-nitro-4H-imidazo[1,2-a][1,4]benzodiazepin-1-one;(2R,3R)-2,3-dihydroxybutanedioic acid |
| SMILES | CCN1CCN(/C=C2/N=C3CN=C(c4ccccc4Cl)c4cc([N+](=O)[O-])ccc4N3C2=O)CC1.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C24H23ClN6O3.C4H6O6/c1-2-28-9-11-29(12-10-28)15-20-24(32)30-21-8-7-16(31(33)34)13-18(21)23(26-14-22(30)27-20)17-5-3-4-6-19(17)25;5-1(3(7)8)2(6)4(9)10/h3-8,13,15H,2,9-12,14H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/b20-15+;/t;1-,2-/m.1/s1 |
| InChIKey | IFQYUEWYONSODF-NYRCATDFSA-N |
| XLogP | 1.20 |
| TPSA | 209.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.03 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|