C25H26ClN6O4P — CID 54350183
6-(2-chlorophenyl)-2-[4-(dimethylphosphorylmethyl)piperazin-1-yl]-4-methylidene-8-nitro-2H-imidazo[1,2-a][1,4]benzodiazepin-1-one (PubChem CID 54350183) has the molecular formula C25H26ClN6O4P and a molecular weight of 540.95 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-2-[4-(dimethylphosphorylmethyl)piperazin-1-yl]-4-methylidene-8-nitro-2H-imidazo[1,2-a][1,4]benzodiazepin-1-one.
| Compound Name | 6-(2-chlorophenyl)-2-[4-(dimethylphosphorylmethyl)piperazin-1-yl]-4-methylidene-8-nitro-2H-imidazo[1,2-a][1,4]benzodiazepin-1-one |
|---|---|
| PubChem CID | 54350183 |
| Molecular Formula | C25H26ClN6O4P |
| Molecular Weight | 540.95 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | 6-(2-chlorophenyl)-2-[4-(dimethylphosphorylmethyl)piperazin-1-yl]-4-methylidene-8-nitro-2H-imidazo[1,2-a][1,4]benzodiazepin-1-one |
| SMILES | C=C1N=C(c2ccccc2Cl)c2cc([N+](=O)[O-])ccc2N2C(=O)C(N3CCN(CP(C)(C)=O)CC3)N=C12 |
| InChI | InChI=1S/C25H26ClN6O4P/c1-16-23-28-24(30-12-10-29(11-13-30)15-37(2,3)36)25(33)31(23)21-9-8-17(32(34)35)14-19(21)22(27-16)18-6-4-5-7-20(18)26/h4-9,14,24H,1,10-13,15H2,2-3H3 |
| InChIKey | UFDWAIMXOSHLGY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 111.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.95 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|