C24H28ClN5O3 — CID 152751335
5-(2-chlorophenyl)-3-(diethylaminomethylidene)-1-[2-(dimethylamino)ethyl]-7-nitro-1,4-benzodiazepin-2-one (PubChem CID 152751335) has the molecular formula C24H28ClN5O3 and a molecular weight of 469.97 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-3-(diethylaminomethylidene)-1-[2-(dimethylamino)ethyl]-7-nitro-1,4-benzodiazepin-2-one.
| Compound Name | 5-(2-chlorophenyl)-3-(diethylaminomethylidene)-1-[2-(dimethylamino)ethyl]-7-nitro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 152751335 |
| Molecular Formula | C24H28ClN5O3 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 5-(2-chlorophenyl)-3-(diethylaminomethylidene)-1-[2-(dimethylamino)ethyl]-7-nitro-1,4-benzodiazepin-2-one |
| SMILES | CCN(C=C1N=C(c2ccccc2Cl)c2cc([N+](=O)[O-])ccc2N(CCN(C)C)C1=O)CC |
| InChI | InChI=1S/C24H28ClN5O3/c1-5-28(6-2)16-21-24(31)29(14-13-27(3)4)22-12-11-17(30(32)33)15-19(22)23(26-21)18-9-7-8-10-20(18)25/h7-12,15-16H,5-6,13-14H2,1-4H3 |
| InChIKey | AKTFOTBENHWMKZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|