C22H22ClN5O2 — CID 21487139
1-[6-(2-chlorophenyl)-2,4-dimethyl-9-nitro-4H-imidazo[1,2-a][1,4]benzodiazepin-1-yl]-N,N-dimethylmethanamine (PubChem CID 21487139) has the molecular formula C22H22ClN5O2 and a molecular weight of 423.90 g/mol. Its IUPAC name is 1-[6-(2-chlorophenyl)-2,4-dimethyl-9-nitro-4H-imidazo[1,2-a][1,4]benzodiazepin-1-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[6-(2-chlorophenyl)-2,4-dimethyl-9-nitro-4H-imidazo[1,2-a][1,4]benzodiazepin-1-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 21487139 |
| Molecular Formula | C22H22ClN5O2 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 1-[6-(2-chlorophenyl)-2,4-dimethyl-9-nitro-4H-imidazo[1,2-a][1,4]benzodiazepin-1-yl]-N,N-dimethylmethanamine |
| SMILES | Cc1nc2n(c1CN(C)C)-c1cc([N+](=O)[O-])ccc1C(c1ccccc1Cl)=NC2C |
| InChI | InChI=1S/C22H22ClN5O2/c1-13-20(12-26(3)4)27-19-11-15(28(29)30)9-10-17(19)21(24-14(2)22(27)25-13)16-7-5-6-8-18(16)23/h5-11,14H,12H2,1-4H3 |
| InChIKey | BGDJPQVXQVIRDN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 76.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|