C17H18N2O4 — CID 174643326
1-[5-acetyl-1,6-dimethyl-4-(2-nitrophenyl)-2H-pyridin-3-yl]ethanone (PubChem CID 174643326) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 1-[5-acetyl-1,6-dimethyl-4-(2-nitrophenyl)-2H-pyridin-3-yl]ethanone.
| Compound Name | 1-[5-acetyl-1,6-dimethyl-4-(2-nitrophenyl)-2H-pyridin-3-yl]ethanone |
|---|---|
| PubChem CID | 174643326 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-[5-acetyl-1,6-dimethyl-4-(2-nitrophenyl)-2H-pyridin-3-yl]ethanone |
| SMILES | CC(=O)C1=C(c2ccccc2[N+](=O)[O-])C(C(C)=O)=C(C)N(C)C1 |
| InChI | InChI=1S/C17H18N2O4/c1-10-16(12(3)21)17(14(11(2)20)9-18(10)4)13-7-5-6-8-15(13)19(22)23/h5-8H,9H2,1-4H3 |
| InChIKey | GSFGPDLKTVZYCK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|