About 2-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)pyridine
2-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)pyridine (PubChem CID 174650963) has the molecular formula C11H7N
and a molecular weight of 153.18 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)pyridine.
Analyze 2-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)pyridine?
The IUPAC name of 2-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)pyridine (CID 174650963) is 2-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)pyridine.
What is the SMILES notation for 2-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)pyridine?
The canonical SMILES for 2-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)pyridine is c1ccc(-c2cc3ccc2=3)nc1.
What is the InChIKey of 2-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)pyridine?
The InChIKey is HCTHRWXCGXDIRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N/c1-2-6-12-11(3-1)10-7-8-4-5-9(8)10/h1-7H.
What are the key properties of 2-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)pyridine?
2-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)pyridine has a molecular weight of 153.18 g/mol, XLogP of 2.35, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bicyclo[2.2.0]hexa-1(4),2,5-trienyl)pyridine is sourced from PubChem (CID 174650963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).