C18H23NO5 — CID 174657730
3-O-tert-butyl 1-O-(pyrrolidine-1-carbonyl) 5-methylbenzene-1,3-dicarboxylate (PubChem CID 174657730) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-(pyrrolidine-1-carbonyl) 5-methylbenzene-1,3-dicarboxylate.
| Compound Name | 3-O-tert-butyl 1-O-(pyrrolidine-1-carbonyl) 5-methylbenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 174657730 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 3-O-tert-butyl 1-O-(pyrrolidine-1-carbonyl) 5-methylbenzene-1,3-dicarboxylate |
| SMILES | Cc1cc(C(=O)OC(=O)N2CCCC2)cc(C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C18H23NO5/c1-12-9-13(11-14(10-12)16(21)24-18(2,3)4)15(20)23-17(22)19-7-5-6-8-19/h9-11H,5-8H2,1-4H3 |
| InChIKey | FICQJRHZTRTMNX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|